C12H25ClO3S — CID 64999861
3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride (PubChem CID 64999861) has the molecular formula C12H25ClO3S and a molecular weight of 284.85 g/mol. Its IUPAC name is 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride.
| Compound Name | 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 64999861 |
| Molecular Formula | C12H25ClO3S |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride |
| SMILES | CCCCCCCOCC(C)(C)CS(=O)(=O)Cl |
| InChI | InChI=1S/C12H25ClO3S/c1-4-5-6-7-8-9-16-10-12(2,3)11-17(13,14)15/h4-11H2,1-3H3 |
| InChIKey | ZBIHUTCJDBNGCG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|