3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride

C12H25ClO3S — CID 64999861

IUPAC3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride
SMILESCCCCCCCOCC(C)(C)CS(=O)(=O)Cl
InChIInChI=1S/C12H25ClO3S/c1-4-5-6-7-8-9-16-10-12(2,3)11-17(13,14)15/h4-11H2,1-3H3
InChIKeyZBIHUTCJDBNGCG-UHFFFAOYSA-N
MW284.85 g/mol
LogP3.57
Rot. Bonds10

About 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride

3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride (PubChem CID 64999861) has the molecular formula C12H25ClO3S and a molecular weight of 284.85 g/mol. Its IUPAC name is 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride
PubChem CID64999861
Molecular FormulaC12H25ClO3S
Molecular Weight284.85 g/mol
Exact Mass284.12
IUPAC Name3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride
SMILESCCCCCCCOCC(C)(C)CS(=O)(=O)Cl
InChIInChI=1S/C12H25ClO3S/c1-4-5-6-7-8-9-16-10-12(2,3)11-17(13,14)15/h4-11H2,1-3H3
InChIKeyZBIHUTCJDBNGCG-UHFFFAOYSA-N
XLogP3.57
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.85
LogP ≤ 53.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride?
The IUPAC name of 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride (CID 64999861) is 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride.
What is the SMILES notation for 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride?
The canonical SMILES for 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride is CCCCCCCOCC(C)(C)CS(=O)(=O)Cl.
What is the InChIKey of 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride?
The InChIKey is ZBIHUTCJDBNGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25ClO3S/c1-4-5-6-7-8-9-16-10-12(2,3)11-17(13,14)15/h4-11H2,1-3H3.
What are the key properties of 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride?
3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride has a molecular weight of 284.85 g/mol, XLogP of 3.57, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptoxy-2,2-dimethylpropane-1-sulfonyl chloride is sourced from PubChem (CID 64999861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).