C10H20BrNO2S — CID 65000232
N-(3-bromo-2,2-dimethylpropyl)-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 65000232) has the molecular formula C10H20BrNO2S and a molecular weight of 298.25 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-N-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-N-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 65000232 |
| Molecular Formula | C10H20BrNO2S |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(CC(C)(C)CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20BrNO2S/c1-10(2,7-11)8-12(3)9-4-5-15(13,14)6-9/h9H,4-8H2,1-3H3 |
| InChIKey | IVMAXMFRUOSRNW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|