C16H23BrO — CID 65001891
1-[[1-(bromomethyl)cyclohexyl]methoxy]ethylbenzene (PubChem CID 65001891) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclohexyl]methoxy]ethylbenzene.
| Compound Name | 1-[[1-(bromomethyl)cyclohexyl]methoxy]ethylbenzene |
|---|---|
| PubChem CID | 65001891 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclohexyl]methoxy]ethylbenzene |
| SMILES | CC(OCC1(CBr)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23BrO/c1-14(15-8-4-2-5-9-15)18-13-16(12-17)10-6-3-7-11-16/h2,4-5,8-9,14H,3,6-7,10-13H2,1H3 |
| InChIKey | ZHZJIJZKOZIGRN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|