C15H31BrN2 — CID 65002076
N'-[[1-(bromomethyl)cyclohexyl]methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (PubChem CID 65002076) has the molecular formula C15H31BrN2 and a molecular weight of 319.33 g/mol. Its IUPAC name is N'-[[1-(bromomethyl)cyclohexyl]methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-[[1-(bromomethyl)cyclohexyl]methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 65002076 |
| Molecular Formula | C15H31BrN2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N'-[[1-(bromomethyl)cyclohexyl]methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)CC1(CBr)CCCCC1 |
| InChI | InChI=1S/C15H31BrN2/c1-4-10-18(12-11-17(2)3)14-15(13-16)8-6-5-7-9-15/h4-14H2,1-3H3 |
| InChIKey | ATNBSXOLKDGUCB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|