C13H27BrN2 — CID 65002615
N'-[[1-(bromomethyl)cyclopentyl]methyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 65002615) has the molecular formula C13H27BrN2 and a molecular weight of 291.28 g/mol. Its IUPAC name is N'-[[1-(bromomethyl)cyclopentyl]methyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[[1-(bromomethyl)cyclopentyl]methyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 65002615 |
| Molecular Formula | C13H27BrN2 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N'-[[1-(bromomethyl)cyclopentyl]methyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)CC1(CBr)CCCC1 |
| InChI | InChI=1S/C13H27BrN2/c1-15(2)9-6-10-16(3)12-13(11-14)7-4-5-8-13/h4-12H2,1-3H3 |
| InChIKey | UVWRKVRMLHFJEE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|