C13H26BrN — CID 65003333
N-[[1-(bromomethyl)cyclopentyl]methyl]-N,3-dimethylbutan-1-amine (PubChem CID 65003333) has the molecular formula C13H26BrN and a molecular weight of 276.26 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopentyl]methyl]-N,3-dimethylbutan-1-amine.
| Compound Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65003333 |
| Molecular Formula | C13H26BrN |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)CC1(CBr)CCCC1 |
| InChI | InChI=1S/C13H26BrN/c1-12(2)6-9-15(3)11-13(10-14)7-4-5-8-13/h12H,4-11H2,1-3H3 |
| InChIKey | OPULJWRDVWFKSB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|