C15H23NO4S — CID 65002702
[1-[(2-methoxy-4-methylphenoxy)methyl]cyclopentyl]methanesulfonamide (PubChem CID 65002702) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is [1-[(2-methoxy-4-methylphenoxy)methyl]cyclopentyl]methanesulfonamide.
| Compound Name | [1-[(2-methoxy-4-methylphenoxy)methyl]cyclopentyl]methanesulfonamide |
|---|---|
| PubChem CID | 65002702 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [1-[(2-methoxy-4-methylphenoxy)methyl]cyclopentyl]methanesulfonamide |
| SMILES | COc1cc(C)ccc1OCC1(CS(N)(=O)=O)CCCC1 |
| InChI | InChI=1S/C15H23NO4S/c1-12-5-6-13(14(9-12)19-2)20-10-15(7-3-4-8-15)11-21(16,17)18/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | CDYWYQUWBOSIQP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |