C16H26BrNO — CID 65003826
2-(bromomethyl)-2-ethyl-N-[(4-methoxyphenyl)methyl]-N-methylbutan-1-amine (PubChem CID 65003826) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(bromomethyl)-2-ethyl-N-[(4-methoxyphenyl)methyl]-N-methylbutan-1-amine.
| Compound Name | 2-(bromomethyl)-2-ethyl-N-[(4-methoxyphenyl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 65003826 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(bromomethyl)-2-ethyl-N-[(4-methoxyphenyl)methyl]-N-methylbutan-1-amine |
| SMILES | CCC(CC)(CBr)CN(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H26BrNO/c1-5-16(6-2,12-17)13-18(3)11-14-7-9-15(19-4)10-8-14/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | NKIODBQHGJTKEM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|