C17H21NO2 — CID 166042056
1,1-dideuterio-N,N-bis[(4-methoxyphenyl)methyl]methanamine (PubChem CID 166042056) has the molecular formula C17H21NO2 and a molecular weight of 273.37 g/mol. Its IUPAC name is 1,1-dideuterio-N,N-bis[(4-methoxyphenyl)methyl]methanamine.
| Compound Name | 1,1-dideuterio-N,N-bis[(4-methoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 166042056 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1,1-dideuterio-N,N-bis[(4-methoxyphenyl)methyl]methanamine |
| SMILES | [2H]C([2H])N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-18(12-14-4-8-16(19-2)9-5-14)13-15-6-10-17(20-3)11-7-15/h4-11H,12-13H2,1-3H3/i1D2 |
| InChIKey | QQOGSEIHPAFZEB-DICFDUPASA-N |
| XLogP | 3.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |