C12H15F3MoNO- — CID 177326696
molybdenum;3,3,3-trifluoro-N-[(4-methoxyphenyl)methyl]-N-methylpropan-1-amine (PubChem CID 177326696) has the molecular formula C12H15F3MoNO- and a molecular weight of 342.19 g/mol. Its IUPAC name is molybdenum;3,3,3-trifluoro-N-[(4-methoxyphenyl)methyl]-N-methylpropan-1-amine.
| Compound Name | molybdenum;3,3,3-trifluoro-N-[(4-methoxyphenyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 177326696 |
| Molecular Formula | C12H15F3MoNO- |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | molybdenum;3,3,3-trifluoro-N-[(4-methoxyphenyl)methyl]-N-methylpropan-1-amine |
| SMILES | COc1ccc(CN(C)C[CH-]C(F)(F)F)cc1.[Mo] |
| InChI | InChI=1S/C12H15F3NO.Mo/c1-16(8-7-12(13,14)15)9-10-3-5-11(17-2)6-4-10;/h3-7H,8-9H2,1-2H3;/q-1; |
| InChIKey | BIRCJJGLIQHSRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|