C13H14BrI3O2 — CID 65004481
4-(bromomethyl)-4-[(2,4,6-triiodophenoxy)methyl]oxane (PubChem CID 65004481) has the molecular formula C13H14BrI3O2 and a molecular weight of 662.87 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[(2,4,6-triiodophenoxy)methyl]oxane.
| Compound Name | 4-(bromomethyl)-4-[(2,4,6-triiodophenoxy)methyl]oxane |
|---|---|
| PubChem CID | 65004481 |
| Molecular Formula | C13H14BrI3O2 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 661.73 |
| IUPAC Name | 4-(bromomethyl)-4-[(2,4,6-triiodophenoxy)methyl]oxane |
| SMILES | BrCC1(COc2c(I)cc(I)cc2I)CCOCC1 |
| InChI | InChI=1S/C13H14BrI3O2/c14-7-13(1-3-18-4-2-13)8-19-12-10(16)5-9(15)6-11(12)17/h5-6H,1-4,7-8H2 |
| InChIKey | YYPMDEPKNUOFLY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|