C14H27BrF3N — CID 65005230
2-(bromomethyl)-N-propan-2-yl-2-propyl-N-(2,2,2-trifluoroethyl)pentan-1-amine (PubChem CID 65005230) has the molecular formula C14H27BrF3N and a molecular weight of 346.28 g/mol. Its IUPAC name is 2-(bromomethyl)-N-propan-2-yl-2-propyl-N-(2,2,2-trifluoroethyl)pentan-1-amine.
| Compound Name | 2-(bromomethyl)-N-propan-2-yl-2-propyl-N-(2,2,2-trifluoroethyl)pentan-1-amine |
|---|---|
| PubChem CID | 65005230 |
| Molecular Formula | C14H27BrF3N |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(bromomethyl)-N-propan-2-yl-2-propyl-N-(2,2,2-trifluoroethyl)pentan-1-amine |
| SMILES | CCCC(CBr)(CCC)CN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H27BrF3N/c1-5-7-13(9-15,8-6-2)10-19(12(3)4)11-14(16,17)18/h12H,5-11H2,1-4H3 |
| InChIKey | YDYMTSGIYNTLQH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|