C11H19BrF3N — CID 165128511
(2R,4S)-4-(bromomethyl)-1-(2-methylpropyl)-2-(trifluoromethyl)piperidine (PubChem CID 165128511) has the molecular formula C11H19BrF3N and a molecular weight of 302.18 g/mol. Its IUPAC name is (2R,4S)-4-(bromomethyl)-1-(2-methylpropyl)-2-(trifluoromethyl)piperidine.
| Compound Name | (2R,4S)-4-(bromomethyl)-1-(2-methylpropyl)-2-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 165128511 |
| Molecular Formula | C11H19BrF3N |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R,4S)-4-(bromomethyl)-1-(2-methylpropyl)-2-(trifluoromethyl)piperidine |
| SMILES | CC(C)CN1CC[C@H](CBr)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C11H19BrF3N/c1-8(2)7-16-4-3-9(6-12)5-10(16)11(13,14)15/h8-10H,3-7H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | PBRVSYQEVKITHS-VHSXEESVSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|