C17H27BrFN — CID 65005275
2-(bromomethyl)-N-[(2-fluorophenyl)methyl]-N-methyl-2-propylpentan-1-amine (PubChem CID 65005275) has the molecular formula C17H27BrFN and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-(bromomethyl)-N-[(2-fluorophenyl)methyl]-N-methyl-2-propylpentan-1-amine.
| Compound Name | 2-(bromomethyl)-N-[(2-fluorophenyl)methyl]-N-methyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 65005275 |
| Molecular Formula | C17H27BrFN |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(bromomethyl)-N-[(2-fluorophenyl)methyl]-N-methyl-2-propylpentan-1-amine |
| SMILES | CCCC(CBr)(CCC)CN(C)Cc1ccccc1F |
| InChI | InChI=1S/C17H27BrFN/c1-4-10-17(13-18,11-5-2)14-20(3)12-15-8-6-7-9-16(15)19/h6-9H,4-5,10-14H2,1-3H3 |
| InChIKey | PSTWLBGSNDNLQG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|