C15H26BrNO — CID 65005420
2-(bromomethyl)-N-(furan-2-ylmethyl)-N-methyl-2-propylpentan-1-amine (PubChem CID 65005420) has the molecular formula C15H26BrNO and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-(bromomethyl)-N-(furan-2-ylmethyl)-N-methyl-2-propylpentan-1-amine.
| Compound Name | 2-(bromomethyl)-N-(furan-2-ylmethyl)-N-methyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 65005420 |
| Molecular Formula | C15H26BrNO |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(bromomethyl)-N-(furan-2-ylmethyl)-N-methyl-2-propylpentan-1-amine |
| SMILES | CCCC(CBr)(CCC)CN(C)Cc1ccco1 |
| InChI | InChI=1S/C15H26BrNO/c1-4-8-15(12-16,9-5-2)13-17(3)11-14-7-6-10-18-14/h6-7,10H,4-5,8-9,11-13H2,1-3H3 |
| InChIKey | XZHDADKPTCUCOI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|