C19H31BrO — CID 65005932
2-[2-(bromomethyl)-2-propylpentoxy]-4-methyl-1-propan-2-ylbenzene (PubChem CID 65005932) has the molecular formula C19H31BrO and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-propylpentoxy]-4-methyl-1-propan-2-ylbenzene.
| Compound Name | 2-[2-(bromomethyl)-2-propylpentoxy]-4-methyl-1-propan-2-ylbenzene |
|---|---|
| PubChem CID | 65005932 |
| Molecular Formula | C19H31BrO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[2-(bromomethyl)-2-propylpentoxy]-4-methyl-1-propan-2-ylbenzene |
| SMILES | CCCC(CBr)(CCC)COc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C19H31BrO/c1-6-10-19(13-20,11-7-2)14-21-18-12-16(5)8-9-17(18)15(3)4/h8-9,12,15H,6-7,10-11,13-14H2,1-5H3 |
| InChIKey | ZEFOYECLGZLQAF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|