C15H30BrN — CID 65007549
N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2-dimethylbutan-2-amine (PubChem CID 65007549) has the molecular formula C15H30BrN and a molecular weight of 304.32 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2-dimethylbutan-2-amine.
| Compound Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 65007549 |
| Molecular Formula | C15H30BrN |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2-dimethylbutan-2-amine |
| SMILES | CCC(C)(C)N(C)CC1(CBr)CCCCCC1 |
| InChI | InChI=1S/C15H30BrN/c1-5-14(2,3)17(4)13-15(12-16)10-8-6-7-9-11-15/h5-13H2,1-4H3 |
| InChIKey | DBKRLYIJAMEIGE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|