C13H12Cl2O2 — CID 65008169
5-(2,6-dichlorophenyl)spiro[2.3]hexane-5-carboxylic acid (PubChem CID 65008169) has the molecular formula C13H12Cl2O2 and a molecular weight of 271.14 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)spiro[2.3]hexane-5-carboxylic acid.
| Compound Name | 5-(2,6-dichlorophenyl)spiro[2.3]hexane-5-carboxylic acid |
|---|---|
| PubChem CID | 65008169 |
| Molecular Formula | C13H12Cl2O2 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-(2,6-dichlorophenyl)spiro[2.3]hexane-5-carboxylic acid |
| SMILES | O=C(O)C1(c2c(Cl)cccc2Cl)CC2(CC2)C1 |
| InChI | InChI=1S/C13H12Cl2O2/c14-8-2-1-3-9(15)10(8)13(11(16)17)6-12(7-13)4-5-12/h1-3H,4-7H2,(H,16,17) |
| InChIKey | RRYDUEOURHCISH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |