C16H20ClN — CID 65008821
N-[[5-(3-chlorophenyl)spiro[2.3]hexan-5-yl]methyl]cyclopropanamine (PubChem CID 65008821) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)spiro[2.3]hexan-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(3-chlorophenyl)spiro[2.3]hexan-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65008821 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[[5-(3-chlorophenyl)spiro[2.3]hexan-5-yl]methyl]cyclopropanamine |
| SMILES | Clc1cccc(C2(CNC3CC3)CC3(CC3)C2)c1 |
| InChI | InChI=1S/C16H20ClN/c17-13-3-1-2-12(8-13)16(11-18-14-4-5-14)9-15(10-16)6-7-15/h1-3,8,14,18H,4-7,9-11H2 |
| InChIKey | FFPQBSTZEOQQNR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |