C17H22BrN — CID 65009612
N-[[2-(3-bromophenyl)spiro[3.3]heptan-2-yl]methyl]cyclopropanamine (PubChem CID 65009612) has the molecular formula C17H22BrN and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[[2-(3-bromophenyl)spiro[3.3]heptan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-bromophenyl)spiro[3.3]heptan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65009612 |
| Molecular Formula | C17H22BrN |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[[2-(3-bromophenyl)spiro[3.3]heptan-2-yl]methyl]cyclopropanamine |
| SMILES | Brc1cccc(C2(CNC3CC3)CC3(CCC3)C2)c1 |
| InChI | InChI=1S/C17H22BrN/c18-14-4-1-3-13(9-14)17(12-19-15-5-6-15)10-16(11-17)7-2-8-16/h1,3-4,9,15,19H,2,5-8,10-12H2 |
| InChIKey | KFLSWOLYYMQHBS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |