C13H20BrN3S — CID 65009413
2-[4-[[1-(bromomethyl)cyclobutyl]methyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 65009413) has the molecular formula C13H20BrN3S and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-[4-[[1-(bromomethyl)cyclobutyl]methyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[[1-(bromomethyl)cyclobutyl]methyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 65009413 |
| Molecular Formula | C13H20BrN3S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[4-[[1-(bromomethyl)cyclobutyl]methyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | BrCC1(CN2CCN(c3nccs3)CC2)CCC1 |
| InChI | InChI=1S/C13H20BrN3S/c14-10-13(2-1-3-13)11-16-5-7-17(8-6-16)12-15-4-9-18-12/h4,9H,1-3,5-8,10-11H2 |
| InChIKey | ZAISNWSFUPCUOT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|