C15H19BrFNO — CID 65010692
1-[2-(bromomethyl)pentyl]-6-fluoro-3,4-dihydroquinolin-2-one (PubChem CID 65010692) has the molecular formula C15H19BrFNO and a molecular weight of 328.23 g/mol. Its IUPAC name is 1-[2-(bromomethyl)pentyl]-6-fluoro-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[2-(bromomethyl)pentyl]-6-fluoro-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 65010692 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-[2-(bromomethyl)pentyl]-6-fluoro-3,4-dihydroquinolin-2-one |
| SMILES | CCCC(CBr)CN1C(=O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H19BrFNO/c1-2-3-11(9-16)10-18-14-6-5-13(17)8-12(14)4-7-15(18)19/h5-6,8,11H,2-4,7,9-10H2,1H3 |
| InChIKey | BIGZHJFNNKHXPS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|