C8H16F3NO3S — CID 65012636
3-methyl-2-(2,2,2-trifluoroethoxymethyl)butane-1-sulfonamide (PubChem CID 65012636) has the molecular formula C8H16F3NO3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethoxymethyl)butane-1-sulfonamide.
| Compound Name | 3-methyl-2-(2,2,2-trifluoroethoxymethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 65012636 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-methyl-2-(2,2,2-trifluoroethoxymethyl)butane-1-sulfonamide |
| SMILES | CC(C)C(COCC(F)(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C8H16F3NO3S/c1-6(2)7(4-16(12,13)14)3-15-5-8(9,10)11/h6-7H,3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | YJKMXSXFGVKMCI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |