C12H22BrN — CID 65013837
1-[[1-(bromomethyl)cyclopropyl]methyl]-3,5-dimethylpiperidine (PubChem CID 65013837) has the molecular formula C12H22BrN and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclopropyl]methyl]-3,5-dimethylpiperidine.
| Compound Name | 1-[[1-(bromomethyl)cyclopropyl]methyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 65013837 |
| Molecular Formula | C12H22BrN |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclopropyl]methyl]-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(CC2(CBr)CC2)C1 |
| InChI | InChI=1S/C12H22BrN/c1-10-5-11(2)7-14(6-10)9-12(8-13)3-4-12/h10-11H,3-9H2,1-2H3 |
| InChIKey | JRZATTOLIWBALV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|