C18H28BrNO — CID 65014971
N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methoxyethanamine (PubChem CID 65014971) has the molecular formula C18H28BrNO and a molecular weight of 354.33 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65014971 |
| Molecular Formula | C18H28BrNO |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1(c2ccc(Br)cc2)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C18H28BrNO/c1-17(2,3)15-11-18(12-15,13-20-9-10-21-4)14-5-7-16(19)8-6-14/h5-8,15,20H,9-13H2,1-4H3 |
| InChIKey | WXQWSIZUYPNWRB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|