C14H29NO3S — CID 65015096
2-(cycloheptyloxymethyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 65015096) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-(cycloheptyloxymethyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | 2-(cycloheptyloxymethyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65015096 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-(cycloheptyloxymethyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)C(COC1CCCCCC1)CS(N)(=O)=O |
| InChI | InChI=1S/C14H29NO3S/c1-14(2,3)12(11-19(15,16)17)10-18-13-8-6-4-5-7-9-13/h12-13H,4-11H2,1-3H3,(H2,15,16,17) |
| InChIKey | LXEHYTGDEBDNAY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |