C12H25NO3S — CID 65015620
2-(cyclopentyloxymethyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 65015620) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 2-(cyclopentyloxymethyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | 2-(cyclopentyloxymethyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65015620 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-(cyclopentyloxymethyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)C(COC1CCCC1)CS(N)(=O)=O |
| InChI | InChI=1S/C12H25NO3S/c1-12(2,3)10(9-17(13,14)15)8-16-11-6-4-5-7-11/h10-11H,4-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | NXFLFCUHQYQNCI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |