C13H17F2N — CID 65017083
1-(3,5-difluorophenyl)-3-propan-2-ylcyclobutan-1-amine (PubChem CID 65017083) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-propan-2-ylcyclobutan-1-amine.
| Compound Name | 1-(3,5-difluorophenyl)-3-propan-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 65017083 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-propan-2-ylcyclobutan-1-amine |
| SMILES | CC(C)C1CC(N)(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C13H17F2N/c1-8(2)9-6-13(16,7-9)10-3-11(14)5-12(15)4-10/h3-5,8-9H,6-7,16H2,1-2H3 |
| InChIKey | JGAPVRFOMUXLKN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |