C12H13F2N — CID 65008174
5-(3,5-difluorophenyl)spiro[2.3]hexan-5-amine (PubChem CID 65008174) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)spiro[2.3]hexan-5-amine.
| Compound Name | 5-(3,5-difluorophenyl)spiro[2.3]hexan-5-amine |
|---|---|
| PubChem CID | 65008174 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 5-(3,5-difluorophenyl)spiro[2.3]hexan-5-amine |
| SMILES | NC1(c2cc(F)cc(F)c2)CC2(CC2)C1 |
| InChI | InChI=1S/C12H13F2N/c13-9-3-8(4-10(14)5-9)12(15)6-11(7-12)1-2-11/h3-5H,1-2,6-7,15H2 |
| InChIKey | VPOYIOMPTYQVHE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |