C18H19F2N — CID 62788504
1-(3,5-difluorophenyl)-4-phenylcyclohexan-1-amine (PubChem CID 62788504) has the molecular formula C18H19F2N and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-4-phenylcyclohexan-1-amine.
| Compound Name | 1-(3,5-difluorophenyl)-4-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 62788504 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(3,5-difluorophenyl)-4-phenylcyclohexan-1-amine |
| SMILES | NC1(c2cc(F)cc(F)c2)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19F2N/c19-16-10-15(11-17(20)12-16)18(21)8-6-14(7-9-18)13-4-2-1-3-5-13/h1-5,10-12,14H,6-9,21H2 |
| InChIKey | CXNWPOZRYHQMLD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |