C20H15N5O2S2 — CID 650200
8-(1,3-benzothiazol-2-ylsulfanyl)-7-benzyl-3-methylpurine-2,6-dione (PubChem CID 650200) has the molecular formula C20H15N5O2S2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-ylsulfanyl)-7-benzyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(1,3-benzothiazol-2-ylsulfanyl)-7-benzyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 650200 |
| Molecular Formula | C20H15N5O2S2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 8-(1,3-benzothiazol-2-ylsulfanyl)-7-benzyl-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Sc1nc3ccccc3s1)n2Cc1ccccc1 |
| InChI | InChI=1S/C20H15N5O2S2/c1-24-16-15(17(26)23-18(24)27)25(11-12-7-3-2-4-8-12)19(22-16)29-20-21-13-9-5-6-10-14(13)28-20/h2-10H,11H2,1H3,(H,23,26,27) |
| InChIKey | TVJWGHMWILCOGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |