C12H17FN2O2 — CID 65020156
1-(5-fluoro-2-nitrophenyl)-4-methylpentan-2-amine (PubChem CID 65020156) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-(5-fluoro-2-nitrophenyl)-4-methylpentan-2-amine.
| Compound Name | 1-(5-fluoro-2-nitrophenyl)-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 65020156 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(5-fluoro-2-nitrophenyl)-4-methylpentan-2-amine |
| SMILES | CC(C)CC(N)Cc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17FN2O2/c1-8(2)5-11(14)7-9-6-10(13)3-4-12(9)15(16)17/h3-4,6,8,11H,5,7,14H2,1-2H3 |
| InChIKey | ARUNBLLIVPDICH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|