C14H13BrClNS — CID 65024641
N-[(5-bromothiophen-2-yl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine (PubChem CID 65024641) has the molecular formula C14H13BrClNS and a molecular weight of 342.69 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 65024641 |
| Molecular Formula | C14H13BrClNS |
| Molecular Weight | 342.69 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine |
| SMILES | ClC1Cc2ccccc2C1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H13BrClNS/c15-13-6-5-10(18-13)8-17-14-11-4-2-1-3-9(11)7-12(14)16/h1-6,12,14,17H,7-8H2 |
| InChIKey | JQXCAQCGDRMPEB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|