C16H14BrClFN — CID 65024859
N-[(5-bromo-2-fluorophenyl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine (PubChem CID 65024859) has the molecular formula C16H14BrClFN and a molecular weight of 354.65 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 65024859 |
| Molecular Formula | C16H14BrClFN |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-chloro-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1ccc(Br)cc1CNC1c2ccccc2CC1Cl |
| InChI | InChI=1S/C16H14BrClFN/c17-12-5-6-15(19)11(7-12)9-20-16-13-4-2-1-3-10(13)8-14(16)18/h1-7,14,16,20H,8-9H2 |
| InChIKey | HFTYGBQJBAUFQP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|