C15H20ClN3 — CID 65025528
1-chloro-N-(3-imidazol-1-ylpropyl)-3-phenylpropan-2-amine (PubChem CID 65025528) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 1-chloro-N-(3-imidazol-1-ylpropyl)-3-phenylpropan-2-amine.
| Compound Name | 1-chloro-N-(3-imidazol-1-ylpropyl)-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 65025528 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-chloro-N-(3-imidazol-1-ylpropyl)-3-phenylpropan-2-amine |
| SMILES | ClCC(Cc1ccccc1)NCCCn1ccnc1 |
| InChI | InChI=1S/C15H20ClN3/c16-12-15(11-14-5-2-1-3-6-14)18-7-4-9-19-10-8-17-13-19/h1-3,5-6,8,10,13,15,18H,4,7,9,11-12H2 |
| InChIKey | AXEUGKUQCXRPIP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|