C16H18N2O5S2 — CID 6502716
methyl 2-[[4-(dimethylsulfamoyl)-5-methylthiophene-2-carbonyl]amino]benzoate (PubChem CID 6502716) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 2-[[4-(dimethylsulfamoyl)-5-methylthiophene-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(dimethylsulfamoyl)-5-methylthiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6502716 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | methyl 2-[[4-(dimethylsulfamoyl)-5-methylthiophene-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(S(=O)(=O)N(C)C)c(C)s1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-10-14(25(21,22)18(2)3)9-13(24-10)15(19)17-12-8-6-5-7-11(12)16(20)23-4/h5-9H,1-4H3,(H,17,19) |
| InChIKey | ZMMCQYXRMNEZJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |