C18H21N3O5S — CID 92664116
methyl 2-[[4-[dimethylsulfamoyl(methyl)amino]benzoyl]amino]benzoate (PubChem CID 92664116) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is methyl 2-[[4-[dimethylsulfamoyl(methyl)amino]benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[4-[dimethylsulfamoyl(methyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 92664116 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | methyl 2-[[4-[dimethylsulfamoyl(methyl)amino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(N(C)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-20(2)27(24,25)21(3)14-11-9-13(10-12-14)17(22)19-16-8-6-5-7-15(16)18(23)26-4/h5-12H,1-4H3,(H,19,22) |
| InChIKey | MYSNBAOUMNXTQC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |