C18H17ClN2 — CID 65027861
N-(2-chloro-2-phenylethyl)-2-methylquinolin-4-amine (PubChem CID 65027861) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-(2-chloro-2-phenylethyl)-2-methylquinolin-4-amine.
| Compound Name | N-(2-chloro-2-phenylethyl)-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 65027861 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-(2-chloro-2-phenylethyl)-2-methylquinolin-4-amine |
| SMILES | Cc1cc(NCC(Cl)c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H17ClN2/c1-13-11-18(15-9-5-6-10-17(15)21-13)20-12-16(19)14-7-3-2-4-8-14/h2-11,16H,12H2,1H3,(H,20,21) |
| InChIKey | ROYWRGJHVHRILX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|