C13H15ClN4O2 — CID 65028280
N-[[3-(chloromethyl)phenyl]methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 65028280) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65028280 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCc2cccc(CCl)c2)nc(OC)n1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-19-12-16-11(17-13(18-12)20-2)15-8-10-5-3-4-9(6-10)7-14/h3-6H,7-8H2,1-2H3,(H,15,16,17,18) |
| InChIKey | FYZZRMBHNMSOTO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|