C11H19ClN4 — CID 65028759
4-N-(1-chloro-2-methylbutan-2-yl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 65028759) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-N-(1-chloro-2-methylbutan-2-yl)-2-N,2-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-chloro-2-methylbutan-2-yl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 65028759 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-N-(1-chloro-2-methylbutan-2-yl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CCC(C)(CCl)Nc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H19ClN4/c1-5-11(2,8-12)15-9-6-7-13-10(14-9)16(3)4/h6-7H,5,8H2,1-4H3,(H,13,14,15) |
| InChIKey | DVBGTFHCTGFDPC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|