C16H19ClN2 — CID 65028937
N-(2-chlorocyclohexyl)-2-methylquinolin-4-amine (PubChem CID 65028937) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-2-methylquinolin-4-amine.
| Compound Name | N-(2-chlorocyclohexyl)-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 65028937 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(2-chlorocyclohexyl)-2-methylquinolin-4-amine |
| SMILES | Cc1cc(NC2CCCCC2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C16H19ClN2/c1-11-10-16(12-6-2-4-8-14(12)18-11)19-15-9-5-3-7-13(15)17/h2,4,6,8,10,13,15H,3,5,7,9H2,1H3,(H,18,19) |
| InChIKey | QRCVYKSWKGIOIV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|