C17H22N2 — CID 79363261
2-methyl-N-(2,2,3,3-tetramethylcyclopropyl)quinolin-4-amine (PubChem CID 79363261) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-methyl-N-(2,2,3,3-tetramethylcyclopropyl)quinolin-4-amine.
| Compound Name | 2-methyl-N-(2,2,3,3-tetramethylcyclopropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 79363261 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-methyl-N-(2,2,3,3-tetramethylcyclopropyl)quinolin-4-amine |
| SMILES | Cc1cc(NC2C(C)(C)C2(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C17H22N2/c1-11-10-14(12-8-6-7-9-13(12)18-11)19-15-16(2,3)17(15,4)5/h6-10,15H,1-5H3,(H,18,19) |
| InChIKey | FJVZOLPHOQTXJR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |