C15H20Cl3N — CID 65030140
1-(chloromethyl)-N-[(2,4-dichlorophenyl)methyl]-4-methylcyclohexan-1-amine (PubChem CID 65030140) has the molecular formula C15H20Cl3N and a molecular weight of 320.69 g/mol. Its IUPAC name is 1-(chloromethyl)-N-[(2,4-dichlorophenyl)methyl]-4-methylcyclohexan-1-amine.
| Compound Name | 1-(chloromethyl)-N-[(2,4-dichlorophenyl)methyl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 65030140 |
| Molecular Formula | C15H20Cl3N |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-(chloromethyl)-N-[(2,4-dichlorophenyl)methyl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(CCl)(NCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl3N/c1-11-4-6-15(10-16,7-5-11)19-9-12-2-3-13(17)8-14(12)18/h2-3,8,11,19H,4-7,9-10H2,1H3 |
| InChIKey | OOPZPEWLNGCBKR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|