C13H18N4O2 — CID 65031697
1-ethyl-N-(3-hydroxy-2-methylpropyl)benzotriazole-5-carboxamide (PubChem CID 65031697) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-ethyl-N-(3-hydroxy-2-methylpropyl)benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-(3-hydroxy-2-methylpropyl)benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 65031697 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-ethyl-N-(3-hydroxy-2-methylpropyl)benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCC(C)CO)ccc21 |
| InChI | InChI=1S/C13H18N4O2/c1-3-17-12-5-4-10(6-11(12)15-16-17)13(19)14-7-9(2)8-18/h4-6,9,18H,3,7-8H2,1-2H3,(H,14,19) |
| InChIKey | JTSWCCRTZCSLJH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |