C17H17ClN4O2 — CID 94183539
N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-1-ethylbenzotriazole-5-carboxamide (PubChem CID 94183539) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-1-ethylbenzotriazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-1-ethylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 94183539 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-1-ethylbenzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NC[C@H](O)c3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C17H17ClN4O2/c1-2-22-15-7-6-12(9-14(15)20-21-22)17(24)19-10-16(23)11-4-3-5-13(18)8-11/h3-9,16,23H,2,10H2,1H3,(H,19,24)/t16-/m0/s1 |
| InChIKey | LJFQNTSKLIAAMY-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |