C10H17ClN2O3S — CID 65032564
N-(1-chloro-2-methylbutan-2-yl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 65032564) has the molecular formula C10H17ClN2O3S and a molecular weight of 280.78 g/mol. Its IUPAC name is N-(1-chloro-2-methylbutan-2-yl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(1-chloro-2-methylbutan-2-yl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 65032564 |
| Molecular Formula | C10H17ClN2O3S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(1-chloro-2-methylbutan-2-yl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCC(C)(CCl)NS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C10H17ClN2O3S/c1-5-10(4,6-11)13-17(14,15)9-7(2)12-16-8(9)3/h13H,5-6H2,1-4H3 |
| InChIKey | MEHIENQQUFPRIB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|