C17H19N3S — CID 65037808
[1-cyclopropyl-2-(5-ethylthiophen-2-yl)benzimidazol-5-yl]methanamine (PubChem CID 65037808) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is [1-cyclopropyl-2-(5-ethylthiophen-2-yl)benzimidazol-5-yl]methanamine.
| Compound Name | [1-cyclopropyl-2-(5-ethylthiophen-2-yl)benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 65037808 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [1-cyclopropyl-2-(5-ethylthiophen-2-yl)benzimidazol-5-yl]methanamine |
| SMILES | CCc1ccc(-c2nc3cc(CN)ccc3n2C2CC2)s1 |
| InChI | InChI=1S/C17H19N3S/c1-2-13-6-8-16(21-13)17-19-14-9-11(10-18)3-7-15(14)20(17)12-4-5-12/h3,6-9,12H,2,4-5,10,18H2,1H3 |
| InChIKey | GLGWIWABNSYWNS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |