About [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine
[2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine (PubChem CID 80537091) has the molecular formula C15H15Br2N3S
and a molecular weight of 429.18 g/mol. Its IUPAC name is [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine |
| PubChem CID | 80537091 |
| Molecular Formula | C15H15Br2N3S |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine |
| SMILES | CCCn1c(-c2cc(Br)c(Br)s2)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C15H15Br2N3S/c1-2-5-20-12-4-3-9(8-18)6-11(12)19-15(20)13-7-10(16)14(17)21-13/h3-4,6-7H,2,5,8,18H2,1H3 |
| InChIKey | MRASRCVUHLSCFE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine?
The IUPAC name of [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine (CID 80537091) is [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine.
What is the SMILES notation for [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine?
The canonical SMILES for [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine is CCCn1c(-c2cc(Br)c(Br)s2)nc2cc(CN)ccc21.
What is the InChIKey of [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine?
The InChIKey is MRASRCVUHLSCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Br2N3S/c1-2-5-20-12-4-3-9(8-18)6-11(12)19-15(20)13-7-10(16)14(17)21-13/h3-4,6-7H,2,5,8,18H2,1H3.
What are the key properties of [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine?
[2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine has a molecular weight of 429.18 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-dibromothiophen-2-yl)-1-propylbenzimidazol-5-yl]methanamine is sourced from PubChem (CID 80537091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).