C12H11FN2O3S2 — CID 6503928
4-[(3-fluorophenyl)sulfamoyl]-N-methylthiophene-2-carboxamide (PubChem CID 6503928) has the molecular formula C12H11FN2O3S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)sulfamoyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 4-[(3-fluorophenyl)sulfamoyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503928 |
| Molecular Formula | C12H11FN2O3S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[(3-fluorophenyl)sulfamoyl]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)Nc2cccc(F)c2)cs1 |
| InChI | InChI=1S/C12H11FN2O3S2/c1-14-12(16)11-6-10(7-19-11)20(17,18)15-9-4-2-3-8(13)5-9/h2-7,15H,1H3,(H,14,16) |
| InChIKey | DTYHMLZOHZPFKP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |