C11H16F3N3S — CID 65040788
2,2,2-trifluoro-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine (PubChem CID 65040788) has the molecular formula C11H16F3N3S and a molecular weight of 279.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
|---|---|
| PubChem CID | 65040788 |
| Molecular Formula | C11H16F3N3S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
| SMILES | Cc1nc(SCCNCC(F)(F)F)nc(C)c1C |
| InChI | InChI=1S/C11H16F3N3S/c1-7-8(2)16-10(17-9(7)3)18-5-4-15-6-11(12,13)14/h15H,4-6H2,1-3H3 |
| InChIKey | JDUFIGSDOUKUMZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|